|
|
| Line 1: |
Line 1: |
| {{chembox
| | Hello and welcome. My name is Figures Wunder. Minnesota is exactly where he's been residing for many years. Playing baseball is the pastime he will by no means quit performing. I utilized to be unemployed but now I am a librarian and the wage has been really fulfilling.<br><br>Here is my webpage home std test ([http://javly.com/?p=56362 stay with me]) |
| | Watchedfields = changed
| |
| | verifiedrevid = 441025344
| |
| | Name = Potassium persulfate
| |
| | ImageFile = Potassium persulfate.png
| |
| | ImageSize = 200px
| |
| | ImageName = Two potassium cations and one peroxydisulfate anion
| |
| | ImageFile1 = Potassium-persulfate-xtal-1997-3D-balls.png
| |
| | ImageName1 = Ball-and-stick model of the crystal structure
| |
| | ImageFile2 = Peroxodisíran draselný.JPG
| |
| | ImageName2 = Potassium persulfate as a white powder
| |
| | ImageName
| |
| | OtherNames = potassium peroxydisulfate <br> Anthion <br> potassium perdisulfate
| |
| | Section1 = {{Chembox Identifiers
| |
| | CASNo = 7727-21-1
| |
| | CASNo_Ref = {{cascite|correct|CAS}}
| |
| | PubChem = 24412
| |
| | EINECS = 231-781-8
| |
| | UNNumber = 1492
| |
| | RTECS = SE0400000
| |
| | SMILES = [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+]
| |
| | ChemSpiderID = 22821
| |
| | InChI = 1/2K.H2O8S2/c;;1-9(2,3)7-8-10(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2
| |
| | InChIKey = USHAGKDGDHPEEY-NUQVWONBAA
| |
| | StdInChI = 1S/2K.H2O8S2/c;;1-9(2,3)7-8-10(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2
| |
| | StdInChIKey = USHAGKDGDHPEEY-UHFFFAOYSA-L
| |
| }}
| |
| | Section2 = {{Chembox Properties
| |
| | Formula = K<sub>2</sub>S<sub>2</sub>O<sub>8</sub>
| |
| | MolarMass = 270.322 g/mol
| |
| | Appearance = white powder
| |
| | Odor = odorless
| |
| | Density = 2.477 g/cm<sup>3</sup><ref name=Brauer/>
| |
| | Solubility = 1.75 g/100 mL (0 °C) <br> 4.49 g/100 ml (20 °C)
| |
| | SolubleOther = insoluble in [[alcohol]]
| |
| | MeltingPt = <100 °C decomp.
| |
| | RefractIndex = 1.467
| |
| }}
| |
| | Section7 = {{Chembox Hazards
| |
| | ExternalMSDS = [http://www.inchem.org/documents/icsc/icsc/eics1133.htm ICSC 1133]
| |
| | EUIndex = 016-061-00-1
| |
| | EUClass = Oxidant ('''O''')<br/>Harmful ('''Xn''')<br/>Irritant ('''Xi''')
| |
| | RPhrases = {{R8}}, {{R22}}, {{R36/37/38}}, {{R42/43}}
| |
| | SPhrases = {{S2}}, {{S22}}, {{S24}}, {{S26}}, {{S37}}
| |
| | NFPA-H = 2
| |
| | NFPA-F = 0
| |
| | NFPA-R = 1
| |
| | NFPA-O = OX
| |
| | FlashPt = Non-flammable
| |
| | PEL =
| |
| }}
| |
| | Section8 = {{Chembox Related
| |
| | OtherAnions = [[Potassium sulfite]]<br/>[[Potassium sulfate]]<br/>[[Potassium peroxymonosulfate]]
| |
| | OtherCations = [[Sodium persulfate]]
| |
| | OtherFunctn =
| |
| | Function =
| |
| | OtherCpds =
| |
| }}
| |
| }}
| |
| :''Not to be confused with [[potassium peroxymonosulfate]].''
| |
| | |
| '''Potassium persulfate''' is the [[inorganic compound]] with the formula [[Potassium|K<sub>2</sub>]][[Sulfate|S<sub>2</sub>O<sub>8</sub>]]. Also known as '''potassium peroxydisulfate''' or KPS, it is a white solid that is highly soluble in water. This salt is a powerful oxidant, commonly used to initiate [[polymerization]]s.
| |
| | |
| ==Preparation==
| |
| Potassium persulfate can be prepared by [[electrolysis]] of a cold solution [[potassium bisulfate]] in [[sulfuric acid]] at a high current density.<ref name=Brauer>F. Feher, "Potassium Peroxydisulfate" in Handbook of Preparative Inorganic Chemistry, 2nd Ed. Edited by G. Brauer, Academic Press, 1963, NY. Vol. 1. p. 392.</ref>
| |
| : 2 KHSO<sub>4</sub> → K<sub>2</sub>S<sub>2</sub>O<sub>8</sub> + H<sub>2</sub>
| |
| | |
| It can also be prepared by adding [[potassium bisulfate]] (KHSO<sub>4</sub>) to a solution of the more soluble salt [[ammonium peroxydisulfate]] (NH<sub>4</sub>HSO<sub>4</sub>). In principle it can be prepared by chemical oxidation of [[potassium sulfate]] using [[fluorine]].
| |
| | |
| ==Uses==
| |
| This salt is used to [[Radical initiator|initiate]] polymerziation of various alkenes leading to commercially important polymers such as [[styrene-butadiene rubber]] and [[polytetrafluoroethylene]] and related materials. In solution, the dianion dissociates to give radicals:<ref name = Ullmann>{{Ullmann | title = Peroxo Compounds, Inorganic | author = Harald Jakob, Stefan Leininger, Thomas Lehmann, Sylvia Jacobi, Sven Gutewort | doi = 10.1002/14356007.a19_177.pub2}}</ref>
| |
| :[O<sub>3</sub>SO-OSO<sub>3</sub>]<sup>2-</sup> <math>\overrightarrow{\leftarrow}</math> 2 [SO<sub>4</sub>]<sup>-</sup>
| |
| | |
| It is used in [[organic chemistry]] as an [[oxidizing agent]],<ref>Encyclopedia of Reagents for Organic Synthesis, vol. 1, pp 193-197(1995)</ref> for instance in the [[Elbs persulfate oxidation]] of [[phenol]]s.
| |
| | |
| As a strong [[bleaching agent]], it is used in hair dye substances as whitening agent with hydrogen peroxide.
| |
| | |
| It is a [[food additive]]{{fact|date=January 2014}}.
| |
| ==Precautions==
| |
| The salt is a strong oxidant and is incompatible with organic compounds.
| |
| | |
| ==References==
| |
| {{reflist}}
| |
| | |
| {{Potassium compounds}}
| |
| {{E number infobox 920-929}}
| |
| | |
| [[Category:Persulfates]]
| |
| [[Category:Potassium compounds]]
| |
| [[Category:Oxidizing agents]]
| |
| [[Category:Radical initiators]]
| |
Hello and welcome. My name is Figures Wunder. Minnesota is exactly where he's been residing for many years. Playing baseball is the pastime he will by no means quit performing. I utilized to be unemployed but now I am a librarian and the wage has been really fulfilling.
Here is my webpage home std test (stay with me)